C16H20N10O3 — CID 23659052
1-[2-[3-methyl-1-(3-methylphenyl)-5-oxo-1,2,4-triazol-4-yl]ethyl]triazole-4,5-dicarbohydrazide (PubChem CID 23659052) has the molecular formula C16H20N10O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is 1-[2-[3-methyl-1-(3-methylphenyl)-5-oxo-1,2,4-triazol-4-yl]ethyl]triazole-4,5-dicarbohydrazide.
| Compound Name | 1-[2-[3-methyl-1-(3-methylphenyl)-5-oxo-1,2,4-triazol-4-yl]ethyl]triazole-4,5-dicarbohydrazide |
|---|---|
| PubChem CID | 23659052 |
| Molecular Formula | C16H20N10O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-[2-[3-methyl-1-(3-methylphenyl)-5-oxo-1,2,4-triazol-4-yl]ethyl]triazole-4,5-dicarbohydrazide |
| SMILES | Cc1cccc(-n2nc(C)n(CCn3nnc(C(=O)NN)c3C(=O)NN)c2=O)c1 |
| InChI | InChI=1S/C16H20N10O3/c1-9-4-3-5-11(8-9)26-16(29)24(10(2)22-26)6-7-25-13(15(28)20-18)12(21-23-25)14(27)19-17/h3-5,8H,6-7,17-18H2,1-2H3,(H,19,27)(H,20,28) |
| InChIKey | GDHNCDRLDJXLPJ-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 180.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|