C20H24N6O2 — CID 70727599
2-[3-methyl-1-(3-methylphenyl)-5-oxo-1,2,4-triazol-4-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]acetamide (PubChem CID 70727599) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 2-[3-methyl-1-(3-methylphenyl)-5-oxo-1,2,4-triazol-4-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]acetamide.
| Compound Name | 2-[3-methyl-1-(3-methylphenyl)-5-oxo-1,2,4-triazol-4-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 70727599 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[3-methyl-1-(3-methylphenyl)-5-oxo-1,2,4-triazol-4-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]acetamide |
| SMILES | Cc1cccc(-n2nc(C)n(CC(=O)NCCNc3ncccc3C)c2=O)c1 |
| InChI | InChI=1S/C20H24N6O2/c1-14-6-4-8-17(12-14)26-20(28)25(16(3)24-26)13-18(27)21-10-11-23-19-15(2)7-5-9-22-19/h4-9,12H,10-11,13H2,1-3H3,(H,21,27)(H,22,23) |
| InChIKey | UWMLCACLJHSZQQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|