C26H20N6O9 — CID 23661307
N-[(1R,8R)-10,18-diacetamido-5,11,17-trinitro-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15,17,19-nonaenyl]acetamide (PubChem CID 23661307) has the molecular formula C26H20N6O9 and a molecular weight of 560.48 g/mol. Its IUPAC name is N-[(1R,8R)-10,18-diacetamido-5,11,17-trinitro-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15,17,19-nonaenyl]acetamide.
| Compound Name | N-[(1R,8R)-10,18-diacetamido-5,11,17-trinitro-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15,17,19-nonaenyl]acetamide |
|---|---|
| PubChem CID | 23661307 |
| Molecular Formula | C26H20N6O9 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | N-[(1R,8R)-10,18-diacetamido-5,11,17-trinitro-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9(14),10,12,15,17,19-nonaenyl]acetamide |
| SMILES | CC(=O)Nc1cc2c(cc1[N+](=O)[O-])[C@H]1c3cc(NC(C)=O)c([N+](=O)[O-])cc3[C@@H]2c2c1ccc([N+](=O)[O-])c2NC(C)=O |
| InChI | InChI=1S/C26H20N6O9/c1-10(33)27-18-6-14-17(9-22(18)32(40)41)24-15-7-19(28-11(2)34)21(31(38)39)8-16(15)23(14)13-4-5-20(30(36)37)26(25(13)24)29-12(3)35/h4-9,23-24H,1-3H3,(H,27,33)(H,28,34)(H,29,35)/t23-,24-/m1/s1 |
| InChIKey | KBIWYPLHOUGYKA-DNQXCXABSA-N |
| XLogP | 4.27 |
| TPSA | 216.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|