C22H30F3N3O2 — CID 23661734
4,4-dimethyl-1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]piperidine-2,6-dione (PubChem CID 23661734) has the molecular formula C22H30F3N3O2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 4,4-dimethyl-1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]piperidine-2,6-dione.
| Compound Name | 4,4-dimethyl-1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 23661734 |
| Molecular Formula | C22H30F3N3O2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 4,4-dimethyl-1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]piperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)N(CCCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)C(=O)C1 |
| InChI | InChI=1S/C22H30F3N3O2/c1-21(2)15-19(29)28(20(30)16-21)9-4-3-8-26-10-12-27(13-11-26)18-7-5-6-17(14-18)22(23,24)25/h5-7,14H,3-4,8-13,15-16H2,1-2H3 |
| InChIKey | UDSHNEUEZSPXAV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|