C20H14ClFNNaO3 — CID 23662249
sodium 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylate (PubChem CID 23662249) has the molecular formula C20H14ClFNNaO3 and a molecular weight of 393.78 g/mol. Its IUPAC name is sodium 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylate.
| Compound Name | sodium 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 23662249 |
| Molecular Formula | C20H14ClFNNaO3 |
| Molecular Weight | 393.78 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | sodium 6-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylate |
| SMILES | O=C([O-])c1cccc(Cc2cc(Cl)ccc2OCc2ccc(F)cc2)n1.[Na+] |
| InChI | InChI=1S/C20H15ClFNO3.Na/c21-15-6-9-19(26-12-13-4-7-16(22)8-5-13)14(10-15)11-17-2-1-3-18(23-17)20(24)25;/h1-10H,11-12H2,(H,24,25);/q;+1/p-1 |
| InChIKey | YNWIQQMAAKDZPB-UHFFFAOYSA-M |
| XLogP | 0.41 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.78 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |