C25H22N7O+ — CID 2366893
(4R)-4-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine (PubChem CID 2366893) has the molecular formula C25H22N7O+ and a molecular weight of 436.50 g/mol. Its IUPAC name is (4R)-4-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine.
| Compound Name | (4R)-4-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
|---|---|
| PubChem CID | 2366893 |
| Molecular Formula | C25H22N7O+ |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (4R)-4-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2[C@@H]2N=C(N)Nc3[nH]c4ccccc4[n+]32)cc1 |
| InChI | InChI=1S/C25H21N7O/c1-33-18-13-11-16(12-14-18)22-19(15-31(30-22)17-7-3-2-4-8-17)23-28-24(26)29-25-27-20-9-5-6-10-21(20)32(23)25/h2-15,23H,1H3,(H3,26,27,28,29)/p+1/t23-/m1/s1 |
| InChIKey | PPVBNRDZNHCFMM-HSZRJFAPSA-O |
| XLogP | 3.60 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|