C16H16N5+ — CID 7326909
(4S)-4-(2-methylphenyl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine (PubChem CID 7326909) has the molecular formula C16H16N5+ and a molecular weight of 278.34 g/mol. Its IUPAC name is (4S)-4-(2-methylphenyl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine.
| Compound Name | (4S)-4-(2-methylphenyl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
|---|---|
| PubChem CID | 7326909 |
| Molecular Formula | C16H16N5+ |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (4S)-4-(2-methylphenyl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
| SMILES | Cc1ccccc1[C@H]1N=C(N)Nc2[nH]c3ccccc3[n+]21 |
| InChI | InChI=1S/C16H15N5/c1-10-6-2-3-7-11(10)14-19-15(17)20-16-18-12-8-4-5-9-13(12)21(14)16/h2-9,14H,1H3,(H3,17,18,19,20)/p+1/t14-/m0/s1 |
| InChIKey | UWJMWQSMLMAMEF-AWEZNQCLSA-O |
| XLogP | 2.05 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|