C15H13ClN5+ — CID 6956301
(4R)-4-(2-chlorophenyl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine (PubChem CID 6956301) has the molecular formula C15H13ClN5+ and a molecular weight of 298.76 g/mol. Its IUPAC name is (4R)-4-(2-chlorophenyl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine.
| Compound Name | (4R)-4-(2-chlorophenyl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
|---|---|
| PubChem CID | 6956301 |
| Molecular Formula | C15H13ClN5+ |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (4R)-4-(2-chlorophenyl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
| SMILES | NC1=N[C@@H](c2ccccc2Cl)[n+]2c([nH]c3ccccc32)N1 |
| InChI | InChI=1S/C15H12ClN5/c16-10-6-2-1-5-9(10)13-19-14(17)20-15-18-11-7-3-4-8-12(11)21(13)15/h1-8,13H,(H3,17,18,19,20)/p+1/t13-/m1/s1 |
| InChIKey | URWIOPDOCKHPTA-CYBMUJFWSA-O |
| XLogP | 2.40 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|