C19H20N5O+ — CID 7646197
(1R)-3-amino-1-(4-propan-2-ylphenyl)-4,5-dihydro-1H-[1,3,5]triazino[1,2-a]quinazolin-11-ium-6-one (PubChem CID 7646197) has the molecular formula C19H20N5O+ and a molecular weight of 334.40 g/mol. Its IUPAC name is (1R)-3-amino-1-(4-propan-2-ylphenyl)-4,5-dihydro-1H-[1,3,5]triazino[1,2-a]quinazolin-11-ium-6-one.
| Compound Name | (1R)-3-amino-1-(4-propan-2-ylphenyl)-4,5-dihydro-1H-[1,3,5]triazino[1,2-a]quinazolin-11-ium-6-one |
|---|---|
| PubChem CID | 7646197 |
| Molecular Formula | C19H20N5O+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (1R)-3-amino-1-(4-propan-2-ylphenyl)-4,5-dihydro-1H-[1,3,5]triazino[1,2-a]quinazolin-11-ium-6-one |
| SMILES | CC(C)c1ccc([C@@H]2N=C(N)Nc3[nH]c(=O)c4ccccc4[n+]32)cc1 |
| InChI | InChI=1S/C19H19N5O/c1-11(2)12-7-9-13(10-8-12)16-21-18(20)23-19-22-17(25)14-5-3-4-6-15(14)24(16)19/h3-11,16H,1-2H3,(H3,20,21,22,23,25)/p+1/t16-/m1/s1 |
| InChIKey | KMJPPKARCCNADU-MRXNPFEDSA-O |
| XLogP | 2.23 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|