C15H14N5O+ — CID 7304704
2-[(4R)-2-amino-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-4-yl]phenol (PubChem CID 7304704) has the molecular formula C15H14N5O+ and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-[(4R)-2-amino-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-4-yl]phenol.
| Compound Name | 2-[(4R)-2-amino-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-4-yl]phenol |
|---|---|
| PubChem CID | 7304704 |
| Molecular Formula | C15H14N5O+ |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[(4R)-2-amino-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-4-yl]phenol |
| SMILES | NC1=N[C@@H](c2ccccc2O)[n+]2c([nH]c3ccccc32)N1 |
| InChI | InChI=1S/C15H13N5O/c16-14-18-13(9-5-1-4-8-12(9)21)20-11-7-3-2-6-10(11)17-15(20)19-14/h1-8,13H,(H4,16,17,18,19,21)/p+1/t13-/m1/s1 |
| InChIKey | YTTXYEKREZVYKC-CYBMUJFWSA-O |
| XLogP | 1.45 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|