C13H11IN5O+ — CID 7341679
(4R)-4-(5-iodofuran-2-yl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine (PubChem CID 7341679) has the molecular formula C13H11IN5O+ and a molecular weight of 380.17 g/mol. Its IUPAC name is (4R)-4-(5-iodofuran-2-yl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine.
| Compound Name | (4R)-4-(5-iodofuran-2-yl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
|---|---|
| PubChem CID | 7341679 |
| Molecular Formula | C13H11IN5O+ |
| Molecular Weight | 380.17 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | (4R)-4-(5-iodofuran-2-yl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
| SMILES | NC1=N[C@@H](c2ccc(I)o2)[n+]2c([nH]c3ccccc32)N1 |
| InChI | InChI=1S/C13H10IN5O/c14-10-6-5-9(20-10)11-17-12(15)18-13-16-7-3-1-2-4-8(7)19(11)13/h1-6,11H,(H3,15,16,17,18)/p+1/t11-/m1/s1 |
| InChIKey | BUBVGTWAZMDGTG-LLVKDONJSA-O |
| XLogP | 1.94 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|