C43H32BLiO3 — CID 23669192
lithium 10,16-diphenyl-13-(2-phenylethynyl)-13-propan-2-yloxy-12,14-dioxa-13-boranuidapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 23669192) has the molecular formula C43H32BLiO3 and a molecular weight of 614.48 g/mol. Its IUPAC name is lithium 10,16-diphenyl-13-(2-phenylethynyl)-13-propan-2-yloxy-12,14-dioxa-13-boranuidapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | lithium 10,16-diphenyl-13-(2-phenylethynyl)-13-propan-2-yloxy-12,14-dioxa-13-boranuidapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 23669192 |
| Molecular Formula | C43H32BLiO3 |
| Molecular Weight | 614.48 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | lithium 10,16-diphenyl-13-(2-phenylethynyl)-13-propan-2-yloxy-12,14-dioxa-13-boranuidapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | CC(C)O[B-]1(C#Cc2ccccc2)Oc2c(-c3ccccc3)cc3ccccc3c2-c2c(c(-c3ccccc3)cc3ccccc23)O1.[Li+] |
| InChI | InChI=1S/C43H32BO3.Li/c1-30(2)45-44(27-26-31-16-6-3-7-17-31)46-42-38(32-18-8-4-9-19-32)28-34-22-12-14-24-36(34)40(42)41-37-25-15-13-23-35(37)29-39(43(41)47-44)33-20-10-5-11-21-33;/h3-25,28-30H,1-2H3;/q-1;+1 |
| InChIKey | RQIKVHRNCGBDBA-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.48 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|