C18H12O2 — CID 70541028
4-phenylbenzo[e][1]benzofuran-1-one (PubChem CID 70541028) has the molecular formula C18H12O2 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-phenylbenzo[e][1]benzofuran-1-one.
| Compound Name | 4-phenylbenzo[e][1]benzofuran-1-one |
|---|---|
| PubChem CID | 70541028 |
| Molecular Formula | C18H12O2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-phenylbenzo[e][1]benzofuran-1-one |
| SMILES | O=C1COc2c(-c3ccccc3)cc3ccccc3c21 |
| InChI | InChI=1S/C18H12O2/c19-16-11-20-18-15(12-6-2-1-3-7-12)10-13-8-4-5-9-14(13)17(16)18/h1-10H,11H2 |
| InChIKey | CCFZDLPKXQAOAE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |