C16H20NNaO3 — CID 23671406
sodium 4-[[(2-methoxyphenyl)methylideneamino]methyl]cyclohexane-1-carboxylate (PubChem CID 23671406) has the molecular formula C16H20NNaO3 and a molecular weight of 297.33 g/mol. Its IUPAC name is sodium 4-[[(2-methoxyphenyl)methylideneamino]methyl]cyclohexane-1-carboxylate.
| Compound Name | sodium 4-[[(2-methoxyphenyl)methylideneamino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23671406 |
| Molecular Formula | C16H20NNaO3 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | sodium 4-[[(2-methoxyphenyl)methylideneamino]methyl]cyclohexane-1-carboxylate |
| SMILES | COc1ccccc1/C=N/CC1CCC(C(=O)[O-])CC1.[Na+] |
| InChI | InChI=1S/C16H21NO3.Na/c1-20-15-5-3-2-4-14(15)11-17-10-12-6-8-13(9-7-12)16(18)19;/h2-5,11-13H,6-10H2,1H3,(H,18,19);/q;+1/p-1/b17-11+; |
| InChIKey | DFJGZSFUPNAQJD-SJDTYFKWSA-M |
| XLogP | -1.33 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|