C12H13N4NaO9S2 — CID 23671826
sodium (2S,3R,5R)-3-methyl-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfonylmethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23671826) has the molecular formula C12H13N4NaO9S2 and a molecular weight of 444.38 g/mol. Its IUPAC name is sodium (2S,3R,5R)-3-methyl-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfonylmethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,3R,5R)-3-methyl-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfonylmethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23671826 |
| Molecular Formula | C12H13N4NaO9S2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | sodium (2S,3R,5R)-3-methyl-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfonylmethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | Cn1[nH]c(=O)c(=O)nc1S(=O)(=O)C[C@@]1(C)[C@H](C(=O)[O-])N2C(=O)C[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C12H14N4O9S2.Na/c1-12(4-26(22,23)11-13-8(18)9(19)14-15(11)2)7(10(20)21)16-5(17)3-6(16)27(12,24)25;/h6-7H,3-4H2,1-2H3,(H,14,19)(H,20,21);/q;+1/p-1/t6-,7+,12+;/m1./s1 |
| InChIKey | FAEMZTLFELNSNG-AWFQHKAPSA-M |
| XLogP | -7.89 |
| TPSA | 196.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | -7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|