About lithium triisoamylborohydride
lithium triisoamylborohydride (PubChem CID 23672398) has the molecular formula C15H33BLi
and a molecular weight of 231.18 g/mol.
Molecular Properties
| Compound Name | lithium triisoamylborohydride |
| PubChem CID | 23672398 |
| Molecular Formula | C15H33BLi |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.28 |
| IUPAC Name | — |
| SMILES | CC(C)CC[B-](CCC(C)C)CCC(C)C.[Li+] |
| InChI | InChI=1S/C15H33B.Li/c1-13(2)7-10-16(11-8-14(3)4)12-9-15(5)6;/h13-15H,7-12H2,1-6H3;/q-1;+1 |
| InChIKey | OJHRFEFCDDXTLG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium triisoamylborohydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium triisoamylborohydride?
The IUPAC name of lithium triisoamylborohydride (CID 23672398) is not available.
What is the SMILES notation for lithium triisoamylborohydride?
The canonical SMILES for lithium triisoamylborohydride is CC(C)CC[B-](CCC(C)C)CCC(C)C.[Li+].
What is the InChIKey of lithium triisoamylborohydride?
The InChIKey is OJHRFEFCDDXTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33B.Li/c1-13(2)7-10-16(11-8-14(3)4)12-9-15(5)6;/h13-15H,7-12H2,1-6H3;/q-1;+1.
What are the key properties of lithium triisoamylborohydride?
lithium triisoamylborohydride has a molecular weight of 231.18 g/mol, XLogP of 2.62, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium triisoamylborohydride is sourced from PubChem (CID 23672398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).