About Lithium trisiamylborohydride
Lithium trisiamylborohydride (PubChem CID 23679709) has the molecular formula C15H33BLi
and a molecular weight of 231.18 g/mol.
Molecular Properties
| Compound Name | Lithium trisiamylborohydride |
| PubChem CID | 23679709 |
| Molecular Formula | C15H33BLi |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.28 |
| IUPAC Name | — |
| SMILES | CC(C)C(C)[B-](C(C)C(C)C)C(C)C(C)C.[Li+] |
| InChI | InChI=1S/C15H33B.Li/c1-10(2)13(7)16(14(8)11(3)4)15(9)12(5)6;/h10-15H,1-9H3;/q-1;+1 |
| InChIKey | MRVNICVEIPIESV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Lithium trisiamylborohydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Lithium trisiamylborohydride?
The IUPAC name of Lithium trisiamylborohydride (CID 23679709) is not available.
What is the SMILES notation for Lithium trisiamylborohydride?
The canonical SMILES for Lithium trisiamylborohydride is CC(C)C(C)[B-](C(C)C(C)C)C(C)C(C)C.[Li+].
What is the InChIKey of Lithium trisiamylborohydride?
The InChIKey is MRVNICVEIPIESV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33B.Li/c1-10(2)13(7)16(14(8)11(3)4)15(9)12(5)6;/h10-15H,1-9H3;/q-1;+1.
What are the key properties of Lithium trisiamylborohydride?
Lithium trisiamylborohydride has a molecular weight of 231.18 g/mol, XLogP of 2.62, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Lithium trisiamylborohydride is sourced from PubChem (CID 23679709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).