C33H32NNaO3 — CID 23679799
sodium 4-[4-[[2,2-diphenylethyl(pentanoyl)amino]methyl]phenyl]benzoate (PubChem CID 23679799) has the molecular formula C33H32NNaO3 and a molecular weight of 513.61 g/mol. Its IUPAC name is sodium 4-[4-[[2,2-diphenylethyl(pentanoyl)amino]methyl]phenyl]benzoate.
| Compound Name | sodium 4-[4-[[2,2-diphenylethyl(pentanoyl)amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 23679799 |
| Molecular Formula | C33H32NNaO3 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | sodium 4-[4-[[2,2-diphenylethyl(pentanoyl)amino]methyl]phenyl]benzoate |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccc(C(=O)[O-])cc2)cc1)CC(c1ccccc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C33H33NO3.Na/c1-2-3-14-32(35)34(24-31(28-10-6-4-7-11-28)29-12-8-5-9-13-29)23-25-15-17-26(18-16-25)27-19-21-30(22-20-27)33(36)37;/h4-13,15-22,31H,2-3,14,23-24H2,1H3,(H,36,37);/q;+1/p-1 |
| InChIKey | SLKKKKFRNXNZLN-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |