C21H18NNaO5 — CID 23681837
sodium 2-[5-benzhydryloxy-2-(hydroxymethyl)-4-oxo-1-pyridinyl]acetate (PubChem CID 23681837) has the molecular formula C21H18NNaO5 and a molecular weight of 387.37 g/mol. Its IUPAC name is sodium 2-[5-benzhydryloxy-2-(hydroxymethyl)-4-oxo-1-pyridinyl]acetate.
| Compound Name | sodium 2-[5-benzhydryloxy-2-(hydroxymethyl)-4-oxo-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 23681837 |
| Molecular Formula | C21H18NNaO5 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | sodium 2-[5-benzhydryloxy-2-(hydroxymethyl)-4-oxo-1-pyridinyl]acetate |
| SMILES | O=C([O-])Cn1cc(OC(c2ccccc2)c2ccccc2)c(=O)cc1CO.[Na+] |
| InChI | InChI=1S/C21H19NO5.Na/c23-14-17-11-18(24)19(12-22(17)13-20(25)26)27-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16;/h1-12,21,23H,13-14H2,(H,25,26);/q;+1/p-1 |
| InChIKey | AQKRNGHNKKWKJH-UHFFFAOYSA-M |
| XLogP | -1.74 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |