C34H27N3O3S3 — CID 19918043
1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanylmethyl]pyridin-4-one (PubChem CID 19918043) has the molecular formula C34H27N3O3S3 and a molecular weight of 621.81 g/mol. Its IUPAC name is 1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanylmethyl]pyridin-4-one.
| Compound Name | 1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanylmethyl]pyridin-4-one |
|---|---|
| PubChem CID | 19918043 |
| Molecular Formula | C34H27N3O3S3 |
| Molecular Weight | 621.81 g/mol |
| Exact Mass | 621.12 |
| IUPAC Name | 1,5-dibenzhydryloxy-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanylmethyl]pyridin-4-one |
| SMILES | O=c1cc(CSc2n[nH]c(=S)s2)n(OC(c2ccccc2)c2ccccc2)cc1OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H27N3O3S3/c38-29-21-28(23-42-34-36-35-33(41)43-34)37(40-32(26-17-9-3-10-18-26)27-19-11-4-12-20-27)22-30(29)39-31(24-13-5-1-6-14-24)25-15-7-2-8-16-25/h1-22,31-32H,23H2,(H,35,41) |
| InChIKey | PKHWBUCVACWMGY-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.81 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|