C26H29N3O4 — CID 56761874
1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-(hydroxymethyl)-5-phenylmethoxypyridin-4-one (PubChem CID 56761874) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-(hydroxymethyl)-5-phenylmethoxypyridin-4-one.
| Compound Name | 1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-(hydroxymethyl)-5-phenylmethoxypyridin-4-one |
|---|---|
| PubChem CID | 56761874 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-(hydroxymethyl)-5-phenylmethoxypyridin-4-one |
| SMILES | O=C(Cn1cc(OCc2ccccc2)c(=O)cc1CO)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O4/c30-19-23-15-24(31)25(33-20-22-9-5-2-6-10-22)17-29(23)18-26(32)28-13-11-27(12-14-28)16-21-7-3-1-4-8-21/h1-10,15,17,30H,11-14,16,18-20H2 |
| InChIKey | BZHJYGHEMPMLCH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |