C23H25NO4 — CID 140931594
2-(hydroxymethyl)-1-(2-hydroxy-4-phenylbutyl)-5-phenylmethoxypyridin-4-one (PubChem CID 140931594) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-(2-hydroxy-4-phenylbutyl)-5-phenylmethoxypyridin-4-one.
| Compound Name | 2-(hydroxymethyl)-1-(2-hydroxy-4-phenylbutyl)-5-phenylmethoxypyridin-4-one |
|---|---|
| PubChem CID | 140931594 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-(hydroxymethyl)-1-(2-hydroxy-4-phenylbutyl)-5-phenylmethoxypyridin-4-one |
| SMILES | O=c1cc(CO)n(CC(O)CCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H25NO4/c25-16-20-13-22(27)23(28-17-19-9-5-2-6-10-19)15-24(20)14-21(26)12-11-18-7-3-1-4-8-18/h1-10,13,15,21,25-26H,11-12,14,16-17H2 |
| InChIKey | GNZPFWCAYUKKJC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |