C15H15FN2O4 — CID 16853831
2-[5-[(4-fluorophenyl)methoxy]-2-(hydroxymethyl)-4-oxo-1-pyridinyl]acetamide (PubChem CID 16853831) has the molecular formula C15H15FN2O4 and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-[5-[(4-fluorophenyl)methoxy]-2-(hydroxymethyl)-4-oxo-1-pyridinyl]acetamide.
| Compound Name | 2-[5-[(4-fluorophenyl)methoxy]-2-(hydroxymethyl)-4-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 16853831 |
| Molecular Formula | C15H15FN2O4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[5-[(4-fluorophenyl)methoxy]-2-(hydroxymethyl)-4-oxo-1-pyridinyl]acetamide |
| SMILES | NC(=O)Cn1cc(OCc2ccc(F)cc2)c(=O)cc1CO |
| InChI | InChI=1S/C15H15FN2O4/c16-11-3-1-10(2-4-11)9-22-14-6-18(7-15(17)21)12(8-19)5-13(14)20/h1-6,19H,7-9H2,(H2,17,21) |
| InChIKey | MXCRRLUZGXMQBY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |