sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate

C14H25NaO7S — CID 23682202

IUPACsodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate
SMILESCCCCCCC(CC(=O)OCC)(C(=O)OCC)S(=O)(=O)[O-].[Na+]
InChIInChI=1S/C14H26O7S.Na/c1-4-7-8-9-10-14(22(17,18)19,13(16)21-6-3)11-12(15)20-5-2;/h4-11H2,1-3H3,(H,17,18,19);/q;+1/p-1
InChIKeyYOZRXSUEBPNTOU-UHFFFAOYSA-M
MW360.40 g/mol
LogP-1.24
Rot. Bonds11

About sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate

sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate (PubChem CID 23682202) has the molecular formula C14H25NaO7S and a molecular weight of 360.40 g/mol. Its IUPAC name is sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate.

Molecular Properties

Compound Namesodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate
PubChem CID23682202
Molecular FormulaC14H25NaO7S
Molecular Weight360.40 g/mol
Exact Mass360.12
IUPAC Namesodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate
SMILESCCCCCCC(CC(=O)OCC)(C(=O)OCC)S(=O)(=O)[O-].[Na+]
InChIInChI=1S/C14H26O7S.Na/c1-4-7-8-9-10-14(22(17,18)19,13(16)21-6-3)11-12(15)20-5-2;/h4-11H2,1-3H3,(H,17,18,19);/q;+1/p-1
InChIKeyYOZRXSUEBPNTOU-UHFFFAOYSA-M
XLogP-1.24
TPSA109.80 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds11
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.40
LogP ≤ 5-1.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate?
The IUPAC name of sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate (CID 23682202) is sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate.
What is the SMILES notation for sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate?
The canonical SMILES for sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate is CCCCCCC(CC(=O)OCC)(C(=O)OCC)S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate?
The InChIKey is YOZRXSUEBPNTOU-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H26O7S.Na/c1-4-7-8-9-10-14(22(17,18)19,13(16)21-6-3)11-12(15)20-5-2;/h4-11H2,1-3H3,(H,17,18,19);/q;+1/p-1.
What are the key properties of sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate?
sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate has a molecular weight of 360.40 g/mol, XLogP of -1.24, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-ethoxy-3-ethoxycarbonyl-1-oxononane-3-sulfonate is sourced from PubChem (CID 23682202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).