C10H16NNaO3 — CID 23686616
sodium 5-hexyl-5-methyl-4-oxo-1,3-oxazol-2-olate (PubChem CID 23686616) has the molecular formula C10H16NNaO3 and a molecular weight of 221.23 g/mol. Its IUPAC name is sodium 5-hexyl-5-methyl-4-oxo-1,3-oxazol-2-olate.
| Compound Name | sodium 5-hexyl-5-methyl-4-oxo-1,3-oxazol-2-olate |
|---|---|
| PubChem CID | 23686616 |
| Molecular Formula | C10H16NNaO3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | sodium 5-hexyl-5-methyl-4-oxo-1,3-oxazol-2-olate |
| SMILES | CCCCCCC1(C)OC([O-])=NC1=O.[Na+] |
| InChI | InChI=1S/C10H17NO3.Na/c1-3-4-5-6-7-10(2)8(12)11-9(13)14-10;/h3-7H2,1-2H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | BPALSJRJYDXLOS-UHFFFAOYSA-M |
| XLogP | -2.01 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|