C15H9ClKNO3 — CID 23688647
potassium 6-chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylate (PubChem CID 23688647) has the molecular formula C15H9ClKNO3 and a molecular weight of 325.79 g/mol. Its IUPAC name is potassium 6-chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylate.
| Compound Name | potassium 6-chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 23688647 |
| Molecular Formula | C15H9ClKNO3 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | potassium 6-chloro-2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)[O-])c3cc(Cl)ccc3n2)o1.[K+] |
| InChI | InChI=1S/C15H10ClNO3.K/c1-8-2-5-14(20-8)13-7-11(15(18)19)10-6-9(16)3-4-12(10)17-13;/h2-7H,1H3,(H,18,19);/q;+1/p-1 |
| InChIKey | IOZODLUOZKZDSY-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |