C21H13FNO3- — CID 2147629
2-[5-(2-fluorophenyl)furan-2-yl]-6-methylquinoline-4-carboxylate (PubChem CID 2147629) has the molecular formula C21H13FNO3- and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)furan-2-yl]-6-methylquinoline-4-carboxylate.
| Compound Name | 2-[5-(2-fluorophenyl)furan-2-yl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2147629 |
| Molecular Formula | C21H13FNO3- |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[5-(2-fluorophenyl)furan-2-yl]-6-methylquinoline-4-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(-c4ccccc4F)o3)cc(C(=O)[O-])c2c1 |
| InChI | InChI=1S/C21H14FNO3/c1-12-6-7-17-14(10-12)15(21(24)25)11-18(23-17)20-9-8-19(26-20)13-4-2-3-5-16(13)22/h2-11H,1H3,(H,24,25)/p-1 |
| InChIKey | MBJDMCUTOQXEPR-UHFFFAOYSA-M |
| XLogP | 3.97 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |