C23H17Cl2NO4 — CID 5239858
2-(2,4-dichlorophenoxy)ethyl 2-(5-methylfuran-2-yl)quinoline-4-carboxylate (PubChem CID 5239858) has the molecular formula C23H17Cl2NO4 and a molecular weight of 442.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl 2-(5-methylfuran-2-yl)quinoline-4-carboxylate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5239858 |
| Molecular Formula | C23H17Cl2NO4 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl 2-(5-methylfuran-2-yl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)OCCOc3ccc(Cl)cc3Cl)c3ccccc3n2)o1 |
| InChI | InChI=1S/C23H17Cl2NO4/c1-14-6-8-22(30-14)20-13-17(16-4-2-3-5-19(16)26-20)23(27)29-11-10-28-21-9-7-15(24)12-18(21)25/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | KTKKZWXBZCBJFG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|