C24H16Cl2FNO3 — CID 3321077
2-(2,4-dichlorophenoxy)ethyl 2-(4-fluorophenyl)quinoline-4-carboxylate (PubChem CID 3321077) has the molecular formula C24H16Cl2FNO3 and a molecular weight of 456.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl 2-(4-fluorophenyl)quinoline-4-carboxylate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl 2-(4-fluorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3321077 |
| Molecular Formula | C24H16Cl2FNO3 |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl 2-(4-fluorophenyl)quinoline-4-carboxylate |
| SMILES | O=C(OCCOc1ccc(Cl)cc1Cl)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C24H16Cl2FNO3/c25-16-7-10-23(20(26)13-16)30-11-12-31-24(29)19-14-22(15-5-8-17(27)9-6-15)28-21-4-2-1-3-18(19)21/h1-10,13-14H,11-12H2 |
| InChIKey | NWLROVBLXCNNLH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|