C23H26N4NaO11P — CID 23690743
sodium [(Z)-[(2R,3R)-3-acetamido-2-phenoxy-2,3-dihydropyran-6-ylidene]methyl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 23690743) has the molecular formula C23H26N4NaO11P and a molecular weight of 588.44 g/mol. Its IUPAC name is sodium [(Z)-[(2R,3R)-3-acetamido-2-phenoxy-2,3-dihydropyran-6-ylidene]methyl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | sodium [(Z)-[(2R,3R)-3-acetamido-2-phenoxy-2,3-dihydropyran-6-ylidene]methyl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 23690743 |
| Molecular Formula | C23H26N4NaO11P |
| Molecular Weight | 588.44 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | sodium [(Z)-[(2R,3R)-3-acetamido-2-phenoxy-2,3-dihydropyran-6-ylidene]methyl] [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | CC(=O)N[C@@H]1C=C/C(=C/OP(=O)([O-])OC[C@H]2O[C@@H](n3ccc(N)nc3=O)[C@H](O)[C@@H]2O)O[C@H]1Oc1ccccc1.[Na+] |
| InChI | InChI=1S/C23H27N4O11P.Na/c1-13(28)25-16-8-7-15(37-22(16)36-14-5-3-2-4-6-14)11-34-39(32,33)35-12-17-19(29)20(30)21(38-17)27-10-9-18(24)26-23(27)31;/h2-11,16-17,19-22,29-30H,12H2,1H3,(H,25,28)(H,32,33)(H2,24,26,31);/q;+1/p-1/b15-11-;/t16-,17-,19-,20-,21-,22-;/m1./s1 |
| InChIKey | LLYOFYWQISECQX-SJIGANKISA-M |
| XLogP | -3.71 |
| TPSA | 216.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.44 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|