C19H27N3O12P- — CID 59163230
[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(E)-[(3R)-3-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-2,3-dihydropyran-6-ylidene]methyl] phosphate (PubChem CID 59163230) has the molecular formula C19H27N3O12P- and a molecular weight of 520.41 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(E)-[(3R)-3-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-2,3-dihydropyran-6-ylidene]methyl] phosphate.
| Compound Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(E)-[(3R)-3-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-2,3-dihydropyran-6-ylidene]methyl] phosphate |
|---|---|
| PubChem CID | 59163230 |
| Molecular Formula | C19H27N3O12P- |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(E)-[(3R)-3-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]-2,3-dihydropyran-6-ylidene]methyl] phosphate |
| SMILES | C[C@@H]1C=C/C(=C\OP(=O)([O-])OC[C@H]2O[C@@H](n3ccc(N)nc3=O)C(O)[C@H]2O)OC1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C19H28N3O12P/c1-9-2-3-10(33-17(9)14(25)11(24)6-23)7-31-35(29,30)32-8-12-15(26)16(27)18(34-12)22-5-4-13(20)21-19(22)28/h2-5,7,9,11-12,14-18,23-27H,6,8H2,1H3,(H,29,30)(H2,20,21,28)/p-1/b10-7+/t9-,11-,12-,14-,15+,16?,17?,18-/m1/s1 |
| InChIKey | ZMSWIXREVNKAGD-TUYDZFPPSA-M |
| XLogP | -2.91 |
| TPSA | 239.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|