About sodium nonan-2-olate
sodium nonan-2-olate (PubChem CID 23695654) has the molecular formula C9H19NaO
and a molecular weight of 166.24 g/mol. Its IUPAC name is sodium nonan-2-olate.
Molecular Properties
| Compound Name | sodium nonan-2-olate |
| PubChem CID | 23695654 |
| Molecular Formula | C9H19NaO |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.13 |
| IUPAC Name | sodium nonan-2-olate |
| SMILES | CCCCCCCC(C)[O-].[Na+] |
| InChI | InChI=1S/C9H19O.Na/c1-3-4-5-6-7-8-9(2)10;/h9H,3-8H2,1-2H3;/q-1;+1 |
| InChIKey | RIAHVHKMTMPRJT-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium nonan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium nonan-2-olate?
The IUPAC name of sodium nonan-2-olate (CID 23695654) is sodium nonan-2-olate.
What is the SMILES notation for sodium nonan-2-olate?
The canonical SMILES for sodium nonan-2-olate is CCCCCCCC(C)[O-].[Na+].
What is the InChIKey of sodium nonan-2-olate?
The InChIKey is RIAHVHKMTMPRJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19O.Na/c1-3-4-5-6-7-8-9(2)10;/h9H,3-8H2,1-2H3;/q-1;+1.
What are the key properties of sodium nonan-2-olate?
sodium nonan-2-olate has a molecular weight of 166.24 g/mol, XLogP of -0.90, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium nonan-2-olate is sourced from PubChem (CID 23695654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).