About lithium hexan-2-olate
lithium hexan-2-olate (PubChem CID 141423009) has the molecular formula C6H13LiO
and a molecular weight of 108.11 g/mol. Its IUPAC name is lithium hexan-2-olate.
Molecular Properties
| Compound Name | lithium hexan-2-olate |
| PubChem CID | 141423009 |
| Molecular Formula | C6H13LiO |
| Molecular Weight | 108.11 g/mol |
| Exact Mass | 108.11 |
| IUPAC Name | lithium hexan-2-olate |
| SMILES | CCCCC(C)[O-].[Li+] |
| InChI | InChI=1S/C6H13O.Li/c1-3-4-5-6(2)7;/h6H,3-5H2,1-2H3;/q-1;+1 |
| InChIKey | RIGHKVCYZNOYDR-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.11 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium hexan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium hexan-2-olate?
The IUPAC name of lithium hexan-2-olate (CID 141423009) is lithium hexan-2-olate.
What is the SMILES notation for lithium hexan-2-olate?
The canonical SMILES for lithium hexan-2-olate is CCCCC(C)[O-].[Li+].
What is the InChIKey of lithium hexan-2-olate?
The InChIKey is RIGHKVCYZNOYDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O.Li/c1-3-4-5-6(2)7;/h6H,3-5H2,1-2H3;/q-1;+1.
What are the key properties of lithium hexan-2-olate?
lithium hexan-2-olate has a molecular weight of 108.11 g/mol, XLogP of -2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium hexan-2-olate is sourced from PubChem (CID 141423009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).