About potassium heptan-3-olate
potassium heptan-3-olate (PubChem CID 140992163) has the molecular formula C7H15KO
and a molecular weight of 154.29 g/mol. Its IUPAC name is potassium heptan-3-olate.
Molecular Properties
| Compound Name | potassium heptan-3-olate |
| PubChem CID | 140992163 |
| Molecular Formula | C7H15KO |
| Molecular Weight | 154.29 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | potassium heptan-3-olate |
| SMILES | CCCCC([O-])CC.[K+] |
| InChI | InChI=1S/C7H15O.K/c1-3-5-6-7(8)4-2;/h7H,3-6H2,1-2H3;/q-1;+1 |
| InChIKey | DRXLPCNHRAXGRO-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.29 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium heptan-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium heptan-3-olate?
The IUPAC name of potassium heptan-3-olate (CID 140992163) is potassium heptan-3-olate.
What is the SMILES notation for potassium heptan-3-olate?
The canonical SMILES for potassium heptan-3-olate is CCCCC([O-])CC.[K+].
What is the InChIKey of potassium heptan-3-olate?
The InChIKey is DRXLPCNHRAXGRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O.K/c1-3-5-6-7(8)4-2;/h7H,3-6H2,1-2H3;/q-1;+1.
What are the key properties of potassium heptan-3-olate?
potassium heptan-3-olate has a molecular weight of 154.29 g/mol, XLogP of -1.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium heptan-3-olate is sourced from PubChem (CID 140992163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).