About sodium 1-aminododecan-2-olate
sodium 1-aminododecan-2-olate (PubChem CID 88793038) has the molecular formula C12H26NNaO
and a molecular weight of 223.34 g/mol. Its IUPAC name is sodium 1-aminododecan-2-olate.
Molecular Properties
| Compound Name | sodium 1-aminododecan-2-olate |
| PubChem CID | 88793038 |
| Molecular Formula | C12H26NNaO |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | sodium 1-aminododecan-2-olate |
| SMILES | CCCCCCCCCCC([O-])CN.[Na+] |
| InChI | InChI=1S/C12H26NO.Na/c1-2-3-4-5-6-7-8-9-10-12(14)11-13;/h12H,2-11,13H2,1H3;/q-1;+1 |
| InChIKey | DUGOREUMLHRKQJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-aminododecan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-aminododecan-2-olate?
The IUPAC name of sodium 1-aminododecan-2-olate (CID 88793038) is sodium 1-aminododecan-2-olate.
What is the SMILES notation for sodium 1-aminododecan-2-olate?
The canonical SMILES for sodium 1-aminododecan-2-olate is CCCCCCCCCCC([O-])CN.[Na+].
What is the InChIKey of sodium 1-aminododecan-2-olate?
The InChIKey is DUGOREUMLHRKQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26NO.Na/c1-2-3-4-5-6-7-8-9-10-12(14)11-13;/h12H,2-11,13H2,1H3;/q-1;+1.
What are the key properties of sodium 1-aminododecan-2-olate?
sodium 1-aminododecan-2-olate has a molecular weight of 223.34 g/mol, XLogP of -0.79, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-aminododecan-2-olate is sourced from PubChem (CID 88793038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).