About dilithium;(3R)-undecan-3-olate
dilithium;(3R)-undecan-3-olate (PubChem CID 134905430) has the molecular formula C11H22Li2O
and a molecular weight of 184.18 g/mol. Its IUPAC name is dilithium;(3R)-undecan-3-olate.
Molecular Properties
| Compound Name | dilithium;(3R)-undecan-3-olate |
| PubChem CID | 134905430 |
| Molecular Formula | C11H22Li2O |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.20 |
| IUPAC Name | dilithium;(3R)-undecan-3-olate |
| SMILES | [CH2-]C[C@@H]([O-])CCCCCCCC.[Li+].[Li+] |
| InChI | InChI=1S/C11H22O.2Li/c1-3-5-6-7-8-9-10-11(12)4-2;;/h11H,2-10H2,1H3;;/q-2;2*+1/t11-;;/m1../s1 |
| InChIKey | BCTCSRHODMSZDJ-NVJADKKVSA-N |
| XLogP | -3.30 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dilithium;(3R)-undecan-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;(3R)-undecan-3-olate?
The IUPAC name of dilithium;(3R)-undecan-3-olate (CID 134905430) is dilithium;(3R)-undecan-3-olate.
What is the SMILES notation for dilithium;(3R)-undecan-3-olate?
The canonical SMILES for dilithium;(3R)-undecan-3-olate is [CH2-]C[C@@H]([O-])CCCCCCCC.[Li+].[Li+].
What is the InChIKey of dilithium;(3R)-undecan-3-olate?
The InChIKey is BCTCSRHODMSZDJ-NVJADKKVSA-N. The full InChI is InChI=1S/C11H22O.2Li/c1-3-5-6-7-8-9-10-11(12)4-2;;/h11H,2-10H2,1H3;;/q-2;2*+1/t11-;;/m1../s1.
What are the key properties of dilithium;(3R)-undecan-3-olate?
dilithium;(3R)-undecan-3-olate has a molecular weight of 184.18 g/mol, XLogP of -3.30, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;(3R)-undecan-3-olate is sourced from PubChem (CID 134905430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).