About 2-ethylhexylazanium hydroxide
2-ethylhexylazanium hydroxide (PubChem CID 23510548) has the molecular formula C8H21NO
and a molecular weight of 147.26 g/mol. Its IUPAC name is 2-ethylhexylazanium hydroxide.
Molecular Properties
| Compound Name | 2-ethylhexylazanium hydroxide |
| PubChem CID | 23510548 |
| Molecular Formula | C8H21NO |
| Molecular Weight | 147.26 g/mol |
| Exact Mass | 147.16 |
| IUPAC Name | 2-ethylhexylazanium hydroxide |
| SMILES | CCCCC(CC)C[NH3+].[OH-] |
| InChI | InChI=1S/C8H19N.H2O/c1-3-5-6-8(4-2)7-9;/h8H,3-7,9H2,1-2H3;1H2 |
| InChIKey | CJTILPJETJPWLF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexylazanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexylazanium hydroxide?
The IUPAC name of 2-ethylhexylazanium hydroxide (CID 23510548) is 2-ethylhexylazanium hydroxide.
What is the SMILES notation for 2-ethylhexylazanium hydroxide?
The canonical SMILES for 2-ethylhexylazanium hydroxide is CCCCC(CC)C[NH3+].[OH-].
What is the InChIKey of 2-ethylhexylazanium hydroxide?
The InChIKey is CJTILPJETJPWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.H2O/c1-3-5-6-8(4-2)7-9;/h8H,3-7,9H2,1-2H3;1H2.
What are the key properties of 2-ethylhexylazanium hydroxide?
2-ethylhexylazanium hydroxide has a molecular weight of 147.26 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexylazanium hydroxide is sourced from PubChem (CID 23510548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).