2-ethylhexylazanium hydroxide

C8H21NO — CID 23510548

IUPAC2-ethylhexylazanium hydroxide
SMILESCCCCC(CC)C[NH3+].[OH-]
InChIInChI=1S/C8H19N.H2O/c1-3-5-6-8(4-2)7-9;/h8H,3-7,9H2,1-2H3;1H2
InChIKeyCJTILPJETJPWLF-UHFFFAOYSA-N
MW147.26 g/mol
LogP1.27
Rot. Bonds5

About 2-ethylhexylazanium hydroxide

2-ethylhexylazanium hydroxide (PubChem CID 23510548) has the molecular formula C8H21NO and a molecular weight of 147.26 g/mol. Its IUPAC name is 2-ethylhexylazanium hydroxide.

Molecular Properties

Compound Name2-ethylhexylazanium hydroxide
PubChem CID23510548
Molecular FormulaC8H21NO
Molecular Weight147.26 g/mol
Exact Mass147.16
IUPAC Name2-ethylhexylazanium hydroxide
SMILESCCCCC(CC)C[NH3+].[OH-]
InChIInChI=1S/C8H19N.H2O/c1-3-5-6-8(4-2)7-9;/h8H,3-7,9H2,1-2H3;1H2
InChIKeyCJTILPJETJPWLF-UHFFFAOYSA-N
XLogP1.27
TPSA57.64 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.26
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-ethylhexylazanium hydroxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethylhexylazanium hydroxide?
The IUPAC name of 2-ethylhexylazanium hydroxide (CID 23510548) is 2-ethylhexylazanium hydroxide.
What is the SMILES notation for 2-ethylhexylazanium hydroxide?
The canonical SMILES for 2-ethylhexylazanium hydroxide is CCCCC(CC)C[NH3+].[OH-].
What is the InChIKey of 2-ethylhexylazanium hydroxide?
The InChIKey is CJTILPJETJPWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.H2O/c1-3-5-6-8(4-2)7-9;/h8H,3-7,9H2,1-2H3;1H2.
What are the key properties of 2-ethylhexylazanium hydroxide?
2-ethylhexylazanium hydroxide has a molecular weight of 147.26 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexylazanium hydroxide is sourced from PubChem (CID 23510548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).