About 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate
2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate (PubChem CID 140555065) has the molecular formula C13H29N3O6
and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate.
Molecular Properties
| Compound Name | 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate |
| PubChem CID | 140555065 |
| Molecular Formula | C13H29N3O6 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate |
| SMILES | CCCCC(CC)C[NH3+].N#CCC[NH3+].O=C([O-])O.O=C([O-])O |
| InChI | InChI=1S/C8H19N.C3H6N2.2CH2O3/c1-3-5-6-8(4-2)7-9;4-2-1-3-5;2*2-1(3)4/h8H,3-7,9H2,1-2H3;1-2,4H2;2*(H2,2,3,4) |
| InChIKey | VPAPPIKQQNJJQH-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 199.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate?
The IUPAC name of 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate (CID 140555065) is 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate.
What is the SMILES notation for 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate?
The canonical SMILES for 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate is CCCCC(CC)C[NH3+].N#CCC[NH3+].O=C([O-])O.O=C([O-])O.
What is the InChIKey of 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate?
The InChIKey is VPAPPIKQQNJJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C3H6N2.2CH2O3/c1-3-5-6-8(4-2)7-9;4-2-1-3-5;2*2-1(3)4/h8H,3-7,9H2,1-2H3;1-2,4H2;2*(H2,2,3,4).
What are the key properties of 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate?
2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate has a molecular weight of 323.39 g/mol, XLogP of -1.64, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethylazanium;2-ethylhexylazanium;hydrogen carbonate is sourced from PubChem (CID 140555065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).