C11H26N2O2 — CID 87642264
N-ethylcarbamate;2-ethylhexylazanium (PubChem CID 87642264) has the molecular formula C11H26N2O2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N-ethylcarbamate;2-ethylhexylazanium.
| Compound Name | N-ethylcarbamate;2-ethylhexylazanium |
|---|---|
| PubChem CID | 87642264 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | N-ethylcarbamate;2-ethylhexylazanium |
| SMILES | CCCCC(CC)C[NH3+].CCNC(=O)[O-] |
| InChI | InChI=1S/C8H19N.C3H7NO2/c1-3-5-6-8(4-2)7-9;1-2-4-3(5)6/h8H,3-7,9H2,1-2H3;4H,2H2,1H3,(H,5,6) |
| InChIKey | AUUUHOWQCBQCFT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |