About dihydroxy(oxo)phosphanium;3-ethylheptane
dihydroxy(oxo)phosphanium;3-ethylheptane (PubChem CID 88713628) has the molecular formula C9H22O3P+
and a molecular weight of 209.25 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;3-ethylheptane.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;3-ethylheptane |
| PubChem CID | 88713628 |
| Molecular Formula | C9H22O3P+ |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | dihydroxy(oxo)phosphanium;3-ethylheptane |
| SMILES | CCCCC(CC)CC.O=[P+](O)O |
| InChI | InChI=1S/C9H20.HO3P/c1-4-7-8-9(5-2)6-3;1-4(2)3/h9H,4-8H2,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | QUVHUQYGWMIDFU-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;3-ethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;3-ethylheptane?
The IUPAC name of dihydroxy(oxo)phosphanium;3-ethylheptane (CID 88713628) is dihydroxy(oxo)phosphanium;3-ethylheptane.
What is the SMILES notation for dihydroxy(oxo)phosphanium;3-ethylheptane?
The canonical SMILES for dihydroxy(oxo)phosphanium;3-ethylheptane is CCCCC(CC)CC.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;3-ethylheptane?
The InChIKey is QUVHUQYGWMIDFU-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H20.HO3P/c1-4-7-8-9(5-2)6-3;1-4(2)3/h9H,4-8H2,1-3H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;3-ethylheptane?
dihydroxy(oxo)phosphanium;3-ethylheptane has a molecular weight of 209.25 g/mol, XLogP of 3.24, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;3-ethylheptane is sourced from PubChem (CID 88713628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).