C12H13N3 — CID 2369597
1-[(1R)-6-bicyclo[3.2.0]hepta-3,5-dienyl]-2-pyridin-2-ylhydrazine (PubChem CID 2369597) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 1-[(1R)-6-bicyclo[3.2.0]hepta-3,5-dienyl]-2-pyridin-2-ylhydrazine.
| Compound Name | 1-[(1R)-6-bicyclo[3.2.0]hepta-3,5-dienyl]-2-pyridin-2-ylhydrazine |
|---|---|
| PubChem CID | 2369597 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1-[(1R)-6-bicyclo[3.2.0]hepta-3,5-dienyl]-2-pyridin-2-ylhydrazine |
| SMILES | C1=CC2=C(NNc3ccccn3)C[C@H]2C1 |
| InChI | InChI=1S/C12H13N3/c1-2-7-13-12(6-1)15-14-11-8-9-4-3-5-10(9)11/h1-3,5-7,9,14H,4,8H2,(H,13,15)/t9-/m1/s1 |
| InChIKey | DTIWJCHRUAJDJL-SECBINFHSA-N |
| XLogP | 2.23 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|