C21H20N2O3 — CID 2369689
[2-[benzyl(ethyl)amino]-2-oxoethyl] (Z)-2-cyano-3-phenylprop-2-enoate (PubChem CID 2369689) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is [2-[benzyl(ethyl)amino]-2-oxoethyl] (Z)-2-cyano-3-phenylprop-2-enoate.
| Compound Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] (Z)-2-cyano-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 2369689 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] (Z)-2-cyano-3-phenylprop-2-enoate |
| SMILES | CCN(Cc1ccccc1)C(=O)COC(=O)/C(C#N)=C\c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c1-2-23(15-18-11-7-4-8-12-18)20(24)16-26-21(25)19(14-22)13-17-9-5-3-6-10-17/h3-13H,2,15-16H2,1H3/b19-13- |
| InChIKey | YECCRORFOWJLJC-UYRXBGFRSA-N |
| XLogP | 3.19 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|