About lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride
lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride (PubChem CID 23700876) has the molecular formula C12H28AlLi
and a molecular weight of 206.28 g/mol. Its IUPAC name is lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride.
Molecular Properties
| Compound Name | lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride |
| PubChem CID | 23700876 |
| Molecular Formula | C12H28AlLi |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.22 |
| IUPAC Name | lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride |
| SMILES | CC(C)C[Al](CC(C)C)C(C)(C)C.[H-].[Li+] |
| InChI | InChI=1S/3C4H9.Al.Li.H/c3*1-4(2)3;;;/h1-3H3;2*4H,1H2,2-3H3;;;/q;;;;+1;-1 |
| InChIKey | KLOLDIUIEMXQFR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride?
The IUPAC name of lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride (CID 23700876) is lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride.
What is the SMILES notation for lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride?
The canonical SMILES for lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride is CC(C)C[Al](CC(C)C)C(C)(C)C.[H-].[Li+].
What is the InChIKey of lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride?
The InChIKey is KLOLDIUIEMXQFR-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.Al.Li.H/c3*1-4(2)3;;;/h1-3H3;2*4H,1H2,2-3H3;;;/q;;;;+1;-1.
What are the key properties of lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride?
lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride has a molecular weight of 206.28 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;tert-butyl-bis(2-methylpropyl)alumane;hydride is sourced from PubChem (CID 23700876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).