C9H9NaO5S2 — CID 23700973
sodium 1-methoxy-4-(2-sulfonatosulfanylacetyl)benzene (PubChem CID 23700973) has the molecular formula C9H9NaO5S2 and a molecular weight of 284.29 g/mol. Its IUPAC name is sodium 1-methoxy-4-(2-sulfonatosulfanylacetyl)benzene.
| Compound Name | sodium 1-methoxy-4-(2-sulfonatosulfanylacetyl)benzene |
|---|---|
| PubChem CID | 23700973 |
| Molecular Formula | C9H9NaO5S2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | sodium 1-methoxy-4-(2-sulfonatosulfanylacetyl)benzene |
| SMILES | COc1ccc(C(=O)CSS(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C9H10O5S2.Na/c1-14-8-4-2-7(3-5-8)9(10)6-15-16(11,12)13;/h2-5H,6H2,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | KUYPBHUUTZDEFH-UHFFFAOYSA-M |
| XLogP | -1.92 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|