About sodium;oxido(dioxo)vanadium;sulfuric acid
sodium;oxido(dioxo)vanadium;sulfuric acid (PubChem CID 23707528) has the molecular formula H2NaO7SV
and a molecular weight of 220.01 g/mol. Its IUPAC name is sodium;oxido(dioxo)vanadium;sulfuric acid.
Molecular Properties
| Compound Name | sodium;oxido(dioxo)vanadium;sulfuric acid |
| PubChem CID | 23707528 |
| Molecular Formula | H2NaO7SV |
| Molecular Weight | 220.01 g/mol |
| Exact Mass | 219.89 |
| IUPAC Name | sodium;oxido(dioxo)vanadium;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=[V](=O)[O-].[Na+] |
| InChI | InChI=1S/Na.H2O4S.3O.V/c;1-5(2,3)4;;;;/h;(H2,1,2,3,4);;;;/q+1;;;;-1; |
| InChIKey | RSARJMWCTADWBW-UHFFFAOYSA-N |
| XLogP | -5.08 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.01 |
| LogP ≤ 5 | -5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;oxido(dioxo)vanadium;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;oxido(dioxo)vanadium;sulfuric acid?
The IUPAC name of sodium;oxido(dioxo)vanadium;sulfuric acid (CID 23707528) is sodium;oxido(dioxo)vanadium;sulfuric acid.
What is the SMILES notation for sodium;oxido(dioxo)vanadium;sulfuric acid?
The canonical SMILES for sodium;oxido(dioxo)vanadium;sulfuric acid is O=S(=O)(O)O.O=[V](=O)[O-].[Na+].
What is the InChIKey of sodium;oxido(dioxo)vanadium;sulfuric acid?
The InChIKey is RSARJMWCTADWBW-UHFFFAOYSA-N. The full InChI is InChI=1S/Na.H2O4S.3O.V/c;1-5(2,3)4;;;;/h;(H2,1,2,3,4);;;;/q+1;;;;-1;.
What are the key properties of sodium;oxido(dioxo)vanadium;sulfuric acid?
sodium;oxido(dioxo)vanadium;sulfuric acid has a molecular weight of 220.01 g/mol, XLogP of -5.08, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;oxido(dioxo)vanadium;sulfuric acid is sourced from PubChem (CID 23707528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).