C21H23ClN3NaO5S — CID 23712405
sodium 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]amino]acetyl]amino]butanoate (PubChem CID 23712405) has the molecular formula C21H23ClN3NaO5S and a molecular weight of 487.94 g/mol. Its IUPAC name is sodium 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]amino]acetyl]amino]butanoate.
| Compound Name | sodium 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]amino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 23712405 |
| Molecular Formula | C21H23ClN3NaO5S |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | sodium 4-[[2-[[2-[(4-chlorophenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl]amino]acetyl]amino]butanoate |
| SMILES | O=C([O-])CCCNC(=O)CNc1ccc2c(c1)CC(NS(=O)(=O)c1ccc(Cl)cc1)C2.[Na+] |
| InChI | InChI=1S/C21H24ClN3O5S.Na/c22-16-4-7-19(8-5-16)31(29,30)25-18-10-14-3-6-17(11-15(14)12-18)24-13-20(26)23-9-1-2-21(27)28;/h3-8,11,18,24-25H,1-2,9-10,12-13H2,(H,23,26)(H,27,28);/q;+1/p-1 |
| InChIKey | MCQDQPDJJHCSCF-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|