C23H25F3N2O5S — CID 14883948
methyl 4-[[2-[2-[[4-(trifluoromethyl)phenyl]sulfonylamino]-2,3-dihydro-1H-inden-5-yl]acetyl]amino]butanoate (PubChem CID 14883948) has the molecular formula C23H25F3N2O5S and a molecular weight of 498.52 g/mol. Its IUPAC name is methyl 4-[[2-[2-[[4-(trifluoromethyl)phenyl]sulfonylamino]-2,3-dihydro-1H-inden-5-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[2-[[4-(trifluoromethyl)phenyl]sulfonylamino]-2,3-dihydro-1H-inden-5-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 14883948 |
| Molecular Formula | C23H25F3N2O5S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | methyl 4-[[2-[2-[[4-(trifluoromethyl)phenyl]sulfonylamino]-2,3-dihydro-1H-inden-5-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)Cc1ccc2c(c1)CC(NS(=O)(=O)c1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C23H25F3N2O5S/c1-33-22(30)3-2-10-27-21(29)12-15-4-5-16-13-19(14-17(16)11-15)28-34(31,32)20-8-6-18(7-9-20)23(24,25)26/h4-9,11,19,28H,2-3,10,12-14H2,1H3,(H,27,29) |
| InChIKey | DLQLNTHPYJGMLC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|