C22H24ClN2NaO5S — CID 67937538
sodium 4-[[2-[6-[(4-chlorophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]acetyl]amino]butanoate (PubChem CID 67937538) has the molecular formula C22H24ClN2NaO5S and a molecular weight of 486.95 g/mol. Its IUPAC name is sodium 4-[[2-[6-[(4-chlorophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]acetyl]amino]butanoate.
| Compound Name | sodium 4-[[2-[6-[(4-chlorophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 67937538 |
| Molecular Formula | C22H24ClN2NaO5S |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | sodium 4-[[2-[6-[(4-chlorophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]acetyl]amino]butanoate |
| SMILES | O=C([O-])CCCNC(=O)Cc1ccc2c(c1)CCC(NS(=O)(=O)c1ccc(Cl)cc1)C2.[Na+] |
| InChI | InChI=1S/C22H25ClN2O5S.Na/c23-18-6-9-20(10-7-18)31(29,30)25-19-8-5-16-12-15(3-4-17(16)14-19)13-21(26)24-11-1-2-22(27)28;/h3-4,6-7,9-10,12,19,25H,1-2,5,8,11,13-14H2,(H,24,26)(H,27,28);/q;+1/p-1 |
| InChIKey | CGUDUWKSTBMMKP-UHFFFAOYSA-M |
| XLogP | -1.63 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|