C2H3Br2NaO3S — CID 23713258
sodium 1,1-dibromoethanesulfonate (PubChem CID 23713258) has the molecular formula C2H3Br2NaO3S and a molecular weight of 289.91 g/mol. Its IUPAC name is sodium 1,1-dibromoethanesulfonate.
| Compound Name | sodium 1,1-dibromoethanesulfonate |
|---|---|
| PubChem CID | 23713258 |
| Molecular Formula | C2H3Br2NaO3S |
| Molecular Weight | 289.91 g/mol |
| Exact Mass | 287.81 |
| IUPAC Name | sodium 1,1-dibromoethanesulfonate |
| SMILES | CC(Br)(Br)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C2H4Br2O3S.Na/c1-2(3,4)8(5,6)7;/h1H3,(H,5,6,7);/q;+1/p-1 |
| InChIKey | YOEDSPGOICMHPK-UHFFFAOYSA-M |
| XLogP | -2.00 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.91 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|