C21H14ClFKN3O3S2 — CID 23715654
potassium [2-benzylsulfanyl-4-chloro-5-[(4-fluorophenyl)carbamoyl]phenyl]sulfonyl-cyanoazanide (PubChem CID 23715654) has the molecular formula C21H14ClFKN3O3S2 and a molecular weight of 514.04 g/mol. Its IUPAC name is potassium [2-benzylsulfanyl-4-chloro-5-[(4-fluorophenyl)carbamoyl]phenyl]sulfonyl-cyanoazanide.
| Compound Name | potassium [2-benzylsulfanyl-4-chloro-5-[(4-fluorophenyl)carbamoyl]phenyl]sulfonyl-cyanoazanide |
|---|---|
| PubChem CID | 23715654 |
| Molecular Formula | C21H14ClFKN3O3S2 |
| Molecular Weight | 514.04 g/mol |
| Exact Mass | 512.98 |
| IUPAC Name | potassium [2-benzylsulfanyl-4-chloro-5-[(4-fluorophenyl)carbamoyl]phenyl]sulfonyl-cyanoazanide |
| SMILES | N#C[N-]S(=O)(=O)c1cc(C(=O)Nc2ccc(F)cc2)c(Cl)cc1SCc1ccccc1.[K+] |
| InChI | InChI=1S/C21H15ClFN3O3S2.K/c22-18-11-19(30-12-14-4-2-1-3-5-14)20(31(28,29)25-13-24)10-17(18)21(27)26-16-8-6-15(23)7-9-16;/h1-11,24H,12H2,(H,26,27);/q;+1/p-1 |
| InChIKey | FTASYGNHFQMBRD-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.04 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|